Methacryloxyethyltrimethyl ammonium chloride

1.Product name: Methacryloxyethyltrimethyl ammonium chloride 2. Chemical formula CH2=C(CH3)COOCH2CH2N(CH3)3C1 3. Purity:78% min

Methacryloxyethyltrimethyl ammonium chloride

Product name: Methacryloxyethyltrimethyl ammonium chloride

Abbreviation: DMC

1. Chemical formula CH2=C(CH3)COOCH2CH2N(CH3)3C1

2. Product quality index

Item	Index
Appearance	Colorless or light yellow transparent liquid
Purity,% ≥	78
Color (APHA) ≤	50
Free acid (by MMA),% ≤	0.2
Polymerization inhibitor, ppm	1000-1500

3. Packing and transportation

1)200L polyethylene plastic barrel, marked with product name, manufacturer and certificate, etc. Net weight 200kg/barrel.

2) Avoid sun exposure, rain and high temperature in transportation.

3)This product is easy to autopolymerized. Stored in dark or cool place. Prevent from direct sunlight.

4)This product has no risk.

Methacryloxyethyltrimethyl ammonium chloride