Chemical Auxiliary Agent Manufacturers - Wuhan Dachu Hexing Technology Co., Ltd.

Good quality 4075-81-4 Calcium propionate

1.Name:Calcium propionate 2.CAS No.4075-81-4 3.Qualified as FCCIV 1.Product descriptionCalcium propionate CAS:4075-81-4 Formula :C6H10CaO4.0-1H2O Molecular :186.22 Apperance :White crystalline powder2.PropertiesWhite crystalline granuIe crystalline powder; odourless or with...

Choline chloride 60%

1.Product name:Choline chloride 2.Appearance:Yellowish-brown flowable Powder 3.Package:25kg PP bag or 25kg Kraft bag 1.Product name:Choline chloride2.Purity:60%3.CAS NO. 67-48-14.Appearance:Yellowish-brown flowable Powder,White or deliquescent crystals5.Package:25kg PP bag or...

Best-seller 4075-81-4 Calcium propionate

1.Name:Calcium propionate 2.CAS No.4075-81-4 3.Qualified as FCCIV 1.Product descriptionCalcium propionate CAS:4075-81-4 Formula :C6H10CaO4.0-1H2O Molecular :186.22 Apperance :White crystalline powder2.PropertiesWhite crystalline granuIe crystalline powder; odourless or with...

107-64-2 Dioctadecyl dimethyl ammonium chloride (D1821)

1.Name:Dioctadecyl dimethyl ammonium chloride 2.CAS no. 107-64-2 3.Competive price & good quality & reliable service Advantage:1.Competive price & good quality & reliable service;2. Rich export experience ,professional after sale support3. Soonest shipment...

Chloramine T

1. Chloramine T 2. Cas no.: 127-65-1 3. white crystal powder 4. Content: 99.0% min 5. 25Kg/50Kg Paper drum Chloramine T(Tosylchloramide sodium) CAS No.: 127-65-1 Molecular Formual: C7H7CINO2SNa:3H20 Molecular Weight: 281.69Properties: white crystal powder, slight chlorine...

Chloramine-B

1. cas:127-52-6 2. used in the disinfection of tableware 3.Packing: 25KG paper drum 4.Soon shipment Specifications:Assay itemIndexAppearancewhite crystalline powderEffective chlorine %24MINPH value9-11Clarityclear and transparentFerric ion ppm10MAXHeavy...

Chloramine T

1. Chloramine T 2. Cas no.: 127-65-1 3. white crystal powder 4. Content: 99.0% min 5. 25Kg/50Kg Paper drum 1. Chloramine T 2. Cas no.: 127-65-1 3. white crystal powder 4. Content: 99.0% min 5. 25Kg/50Kg Paper drumChloramine T Product NameChloramine - TCAS...

Chloramine T

1. Chloramine T 2. Cas no.: 127-65-1 3. white crystal powder 4. Content: 99.0% min 5. 25Kg/50Kg Paper drum 1. Chloramine T 2. Cas no.: 127-65-1 3. white crystal powder 4. Content: 99.0% min 5. 25Kg/50Kg Paper drumChloramine T Product NameChloramine - TCAS...

Chloramine T

1. Chloramine T 2. Cas no.: 127-65-1 3. white crystal powder 4. Content: 99.0% min 5. 25Kg/50Kg Paper drum Chloramine T(Tosylchloramide sodium) CAS No.: 127-65-1 Molecular Formual: C7H7CINO2SNa:3H20 Molecular Weight: 281.69 Properties: white crystal powder, slight...

Methacryloxyethyltrimethyl ammonium chloride

1.Product name: Methacryloxyethyltrimethyl ammonium chloride 2. Chemical formula CH2=C(CH3)COOCH2CH2N(CH3)3C1 3. Purity:78% min Methacryloxyethyltrimethyl ammonium chlorideProduct name: Methacryloxyethyltrimethyl ammonium chlorideAbbreviation: DMC1. Chemical...